C10H9BrF2O3 — CID 117475596
4-(5-bromo-2,3-difluoro-4-hydroxyphenyl)butanoic acid (PubChem CID 117475596) has the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. Its IUPAC name is 4-(5-bromo-2,3-difluoro-4-hydroxyphenyl)butanoic acid.
| Compound Name | 4-(5-bromo-2,3-difluoro-4-hydroxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 117475596 |
| Molecular Formula | C10H9BrF2O3 |
| Molecular Weight | 295.08 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 4-(5-bromo-2,3-difluoro-4-hydroxyphenyl)butanoic acid |
| SMILES | O=C(O)CCCc1cc(Br)c(O)c(F)c1F |
| InChI | InChI=1S/C10H9BrF2O3/c11-6-4-5(2-1-3-7(14)15)8(12)9(13)10(6)16/h4,16H,1-3H2,(H,14,15) |
| InChIKey | XQEXVRJEHZXQGT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.08 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|