C9H5F3O5S — CID 117453269
2-oxo-2-(2,3,5-trifluoro-4-methylsulfonylphenyl)acetic acid (PubChem CID 117453269) has the molecular formula C9H5F3O5S and a molecular weight of 282.19 g/mol. Its IUPAC name is 2-oxo-2-(2,3,5-trifluoro-4-methylsulfonylphenyl)acetic acid.
| Compound Name | 2-oxo-2-(2,3,5-trifluoro-4-methylsulfonylphenyl)acetic acid |
|---|---|
| PubChem CID | 117453269 |
| Molecular Formula | C9H5F3O5S |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 2-oxo-2-(2,3,5-trifluoro-4-methylsulfonylphenyl)acetic acid |
| SMILES | CS(=O)(=O)c1c(F)cc(C(=O)C(=O)O)c(F)c1F |
| InChI | InChI=1S/C9H5F3O5S/c1-18(16,17)8-4(10)2-3(5(11)6(8)12)7(13)9(14)15/h2H,1H3,(H,14,15) |
| InChIKey | IANVPKKONFXFOZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|