C9H10F3NO2S — CID 117385246
1-(2,3,5-trifluoro-4-methylsulfonylphenyl)ethanamine (PubChem CID 117385246) has the molecular formula C9H10F3NO2S and a molecular weight of 253.24 g/mol. Its IUPAC name is 1-(2,3,5-trifluoro-4-methylsulfonylphenyl)ethanamine.
| Compound Name | 1-(2,3,5-trifluoro-4-methylsulfonylphenyl)ethanamine |
|---|---|
| PubChem CID | 117385246 |
| Molecular Formula | C9H10F3NO2S |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 1-(2,3,5-trifluoro-4-methylsulfonylphenyl)ethanamine |
| SMILES | CC(N)c1cc(F)c(S(C)(=O)=O)c(F)c1F |
| InChI | InChI=1S/C9H10F3NO2S/c1-4(13)5-3-6(10)9(16(2,14)15)8(12)7(5)11/h3-4H,13H2,1-2H3 |
| InChIKey | IDRUKDNBHQMQFJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|