C13H18Cl3N5O2 — CID 85402876
1-[amino-[2-(2,4,5-trichlorophenoxy)ethoxyamino]methylidene]-2-propan-2-ylguanidine (PubChem CID 85402876) has the molecular formula C13H18Cl3N5O2 and a molecular weight of 382.68 g/mol. Its IUPAC name is 1-[amino-[2-(2,4,5-trichlorophenoxy)ethoxyamino]methylidene]-2-propan-2-ylguanidine.
| Compound Name | 1-[amino-[2-(2,4,5-trichlorophenoxy)ethoxyamino]methylidene]-2-propan-2-ylguanidine |
|---|---|
| PubChem CID | 85402876 |
| Molecular Formula | C13H18Cl3N5O2 |
| Molecular Weight | 382.68 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 1-[amino-[2-(2,4,5-trichlorophenoxy)ethoxyamino]methylidene]-2-propan-2-ylguanidine |
| SMILES | CC(C)/N=C(\N)N=C(N)NOCCOc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl3N5O2/c1-7(2)19-12(17)20-13(18)21-23-4-3-22-11-6-9(15)8(14)5-10(11)16/h5-7H,3-4H2,1-2H3,(H5,17,18,19,20,21) |
| InChIKey | YHMOEMRHMMTHMK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.68 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|