C21H34Cl3N5O2 — CID 73119395
1-[amino-[3-(2,4,5-trichlorophenoxy)propoxyamino]methylidene]-2-decylguanidine (PubChem CID 73119395) has the molecular formula C21H34Cl3N5O2 and a molecular weight of 494.90 g/mol. Its IUPAC name is 1-[amino-[3-(2,4,5-trichlorophenoxy)propoxyamino]methylidene]-2-decylguanidine.
| Compound Name | 1-[amino-[3-(2,4,5-trichlorophenoxy)propoxyamino]methylidene]-2-decylguanidine |
|---|---|
| PubChem CID | 73119395 |
| Molecular Formula | C21H34Cl3N5O2 |
| Molecular Weight | 494.90 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 1-[amino-[3-(2,4,5-trichlorophenoxy)propoxyamino]methylidene]-2-decylguanidine |
| SMILES | CCCCCCCCCC/N=C(\N)N=C(N)NOCCCOc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H34Cl3N5O2/c1-2-3-4-5-6-7-8-9-11-27-20(25)28-21(26)29-31-13-10-12-30-19-15-17(23)16(22)14-18(19)24/h14-15H,2-13H2,1H3,(H5,25,26,27,28,29) |
| InChIKey | SSUFUJWACQGKGE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.90 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|