C11H14F3N3 — CID 62812620
2-(2-methylpropyl)-1-(2,3,5-trifluorophenyl)guanidine (PubChem CID 62812620) has the molecular formula C11H14F3N3 and a molecular weight of 245.25 g/mol. Its IUPAC name is 2-(2-methylpropyl)-1-(2,3,5-trifluorophenyl)guanidine.
| Compound Name | 2-(2-methylpropyl)-1-(2,3,5-trifluorophenyl)guanidine |
|---|---|
| PubChem CID | 62812620 |
| Molecular Formula | C11H14F3N3 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 2-(2-methylpropyl)-1-(2,3,5-trifluorophenyl)guanidine |
| SMILES | CC(C)C/N=C(\N)Nc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C11H14F3N3/c1-6(2)5-16-11(15)17-9-4-7(12)3-8(13)10(9)14/h3-4,6H,5H2,1-2H3,(H3,15,16,17) |
| InChIKey | QSUXVANDLKWZRB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|