C15H24F3NSi — CID 141042498
2,3,5-trifluoro-N-tri(propan-2-yl)silylaniline (PubChem CID 141042498) has the molecular formula C15H24F3NSi and a molecular weight of 303.44 g/mol. Its IUPAC name is 2,3,5-trifluoro-N-tri(propan-2-yl)silylaniline.
| Compound Name | 2,3,5-trifluoro-N-tri(propan-2-yl)silylaniline |
|---|---|
| PubChem CID | 141042498 |
| Molecular Formula | C15H24F3NSi |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2,3,5-trifluoro-N-tri(propan-2-yl)silylaniline |
| SMILES | CC(C)[Si](Nc1cc(F)cc(F)c1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C15H24F3NSi/c1-9(2)20(10(3)4,11(5)6)19-14-8-12(16)7-13(17)15(14)18/h7-11,19H,1-6H3 |
| InChIKey | SGALGNGHLFAPNQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|