C15H20F3N5O3 — CID 75012417
1-[amino-[3-[4-(trifluoromethoxy)phenoxy]propoxyamino]methylidene]-2-cyclopropylguanidine (PubChem CID 75012417) has the molecular formula C15H20F3N5O3 and a molecular weight of 375.35 g/mol. Its IUPAC name is 1-[amino-[3-[4-(trifluoromethoxy)phenoxy]propoxyamino]methylidene]-2-cyclopropylguanidine.
| Compound Name | 1-[amino-[3-[4-(trifluoromethoxy)phenoxy]propoxyamino]methylidene]-2-cyclopropylguanidine |
|---|---|
| PubChem CID | 75012417 |
| Molecular Formula | C15H20F3N5O3 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 1-[amino-[3-[4-(trifluoromethoxy)phenoxy]propoxyamino]methylidene]-2-cyclopropylguanidine |
| SMILES | NC(=N/C(N)=N/C1CC1)NOCCCOc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H20F3N5O3/c16-15(17,18)26-12-6-4-11(5-7-12)24-8-1-9-25-23-14(20)22-13(19)21-10-2-3-10/h4-7,10H,1-3,8-9H2,(H5,19,20,21,22,23) |
| InChIKey | JESWUJNDNQILLW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|