C12H12F5N3O — CID 120514472
2-(3,3-difluorocyclobutyl)-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 120514472) has the molecular formula C12H12F5N3O and a molecular weight of 309.24 g/mol. Its IUPAC name is 2-(3,3-difluorocyclobutyl)-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-(3,3-difluorocyclobutyl)-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 120514472 |
| Molecular Formula | C12H12F5N3O |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-(3,3-difluorocyclobutyl)-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | N/C(=N\C1CC(F)(F)C1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H12F5N3O/c13-11(14)5-8(6-11)20-10(18)19-7-1-3-9(4-2-7)21-12(15,16)17/h1-4,8H,5-6H2,(H3,18,19,20) |
| InChIKey | RNUKMSHDUULUGI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|