C14H20F2IN3O — CID 120514521
2-(3,3-difluorocyclobutyl)-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide (PubChem CID 120514521) has the molecular formula C14H20F2IN3O and a molecular weight of 411.23 g/mol. Its IUPAC name is 2-(3,3-difluorocyclobutyl)-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-(3,3-difluorocyclobutyl)-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120514521 |
| Molecular Formula | C14H20F2IN3O |
| Molecular Weight | 411.23 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 2-(3,3-difluorocyclobutyl)-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
| SMILES | CC(C)Oc1ccc(N/C(N)=N/C2CC(F)(F)C2)cc1.I |
| InChI | InChI=1S/C14H19F2N3O.HI/c1-9(2)20-12-5-3-10(4-6-12)18-13(17)19-11-7-14(15,16)8-11;/h3-6,9,11H,7-8H2,1-2H3,(H3,17,18,19);1H |
| InChIKey | KSQGPTLDHIWUPD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.23 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|