C18H27N3OS — CID 122101606
1-(4-propan-2-yloxyphenyl)-2-(6-thiaspiro[2.5]octan-2-ylmethyl)guanidine (PubChem CID 122101606) has the molecular formula C18H27N3OS and a molecular weight of 333.50 g/mol. Its IUPAC name is 1-(4-propan-2-yloxyphenyl)-2-(6-thiaspiro[2.5]octan-2-ylmethyl)guanidine.
| Compound Name | 1-(4-propan-2-yloxyphenyl)-2-(6-thiaspiro[2.5]octan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 122101606 |
| Molecular Formula | C18H27N3OS |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-(4-propan-2-yloxyphenyl)-2-(6-thiaspiro[2.5]octan-2-ylmethyl)guanidine |
| SMILES | CC(C)Oc1ccc(N/C(N)=N/CC2CC23CCSCC3)cc1 |
| InChI | InChI=1S/C18H27N3OS/c1-13(2)22-16-5-3-15(4-6-16)21-17(19)20-12-14-11-18(14)7-9-23-10-8-18/h3-6,13-14H,7-12H2,1-2H3,(H3,19,20,21) |
| InChIKey | BMPRKPYRMDDVFM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|