C20H34N4O — CID 111056225
2-[2-cyclohexyl-2-(dimethylamino)ethyl]-1-(4-propan-2-yloxyphenyl)guanidine (PubChem CID 111056225) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is 2-[2-cyclohexyl-2-(dimethylamino)ethyl]-1-(4-propan-2-yloxyphenyl)guanidine.
| Compound Name | 2-[2-cyclohexyl-2-(dimethylamino)ethyl]-1-(4-propan-2-yloxyphenyl)guanidine |
|---|---|
| PubChem CID | 111056225 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 2-[2-cyclohexyl-2-(dimethylamino)ethyl]-1-(4-propan-2-yloxyphenyl)guanidine |
| SMILES | CC(C)Oc1ccc(N/C(N)=N/CC(C2CCCCC2)N(C)C)cc1 |
| InChI | InChI=1S/C20H34N4O/c1-15(2)25-18-12-10-17(11-13-18)23-20(21)22-14-19(24(3)4)16-8-6-5-7-9-16/h10-13,15-16,19H,5-9,14H2,1-4H3,(H3,21,22,23) |
| InChIKey | DGCMJKVXFFLJHM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|