C20H23N3O — CID 119164366
2-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl)-1-(4-propan-2-yloxyphenyl)guanidine (PubChem CID 119164366) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl)-1-(4-propan-2-yloxyphenyl)guanidine.
| Compound Name | 2-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl)-1-(4-propan-2-yloxyphenyl)guanidine |
|---|---|
| PubChem CID | 119164366 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl)-1-(4-propan-2-yloxyphenyl)guanidine |
| SMILES | CC(C)Oc1ccc(N/C(N)=N/C2C3Cc4ccccc4C32)cc1 |
| InChI | InChI=1S/C20H23N3O/c1-12(2)24-15-9-7-14(8-10-15)22-20(21)23-19-17-11-13-5-3-4-6-16(13)18(17)19/h3-10,12,17-19H,11H2,1-2H3,(H3,21,22,23) |
| InChIKey | FBRFRRRIMOHDEE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|