C10H11F2NO2 — CID 133082521
(2R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)propan-2-amine (PubChem CID 133082521) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is (2R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)propan-2-amine.
| Compound Name | (2R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)propan-2-amine |
|---|---|
| PubChem CID | 133082521 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | (2R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)propan-2-amine |
| SMILES | C[C@@H](N)Cc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C10H11F2NO2/c1-6(13)4-7-2-3-8-9(5-7)15-10(11,12)14-8/h2-3,5-6H,4,13H2,1H3/t6-/m1/s1 |
| InChIKey | BHDXKBALNFHXDV-ZCFIWIBFSA-N |
| XLogP | 1.90 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |