C12H14F2O3 — CID 116998259
2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]butan-1-ol (PubChem CID 116998259) has the molecular formula C12H14F2O3 and a molecular weight of 244.24 g/mol. Its IUPAC name is 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]butan-1-ol.
| Compound Name | 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]butan-1-ol |
|---|---|
| PubChem CID | 116998259 |
| Molecular Formula | C12H14F2O3 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]butan-1-ol |
| SMILES | CCC(CO)Cc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C12H14F2O3/c1-2-8(7-15)5-9-3-4-10-11(6-9)17-12(13,14)16-10/h3-4,6,8,15H,2,5,7H2,1H3 |
| InChIKey | OHOWKRDLTPGEHC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |