C13H18O3 — CID 116930737
2-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)butan-1-ol (PubChem CID 116930737) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)butan-1-ol.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)butan-1-ol |
|---|---|
| PubChem CID | 116930737 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)butan-1-ol |
| SMILES | CCC(CO)Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H18O3/c1-2-10(9-14)7-11-3-4-12-13(8-11)16-6-5-15-12/h3-4,8,10,14H,2,5-7,9H2,1H3 |
| InChIKey | YZLNRXLRFNFBCI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |