C9H8F2O5S — CID 118084149
(2,2-difluoro-1,3-benzodioxol-5-yl)methyl methanesulfonate (PubChem CID 118084149) has the molecular formula C9H8F2O5S and a molecular weight of 266.22 g/mol. Its IUPAC name is (2,2-difluoro-1,3-benzodioxol-5-yl)methyl methanesulfonate.
| Compound Name | (2,2-difluoro-1,3-benzodioxol-5-yl)methyl methanesulfonate |
|---|---|
| PubChem CID | 118084149 |
| Molecular Formula | C9H8F2O5S |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | (2,2-difluoro-1,3-benzodioxol-5-yl)methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C9H8F2O5S/c1-17(12,13)14-5-6-2-3-7-8(4-6)16-9(10,11)15-7/h2-4H,5H2,1H3 |
| InChIKey | CIHMWMSMLVNFNL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|