C18H16F2O5 — CID 121433253
ethyl 4-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]ethyl]benzoate (PubChem CID 121433253) has the molecular formula C18H16F2O5 and a molecular weight of 350.32 g/mol. Its IUPAC name is ethyl 4-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]ethyl]benzoate.
| Compound Name | ethyl 4-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]ethyl]benzoate |
|---|---|
| PubChem CID | 121433253 |
| Molecular Formula | C18H16F2O5 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | ethyl 4-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]ethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CCOc2ccc3c(c2)OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C18H16F2O5/c1-2-22-17(21)13-5-3-12(4-6-13)9-10-23-14-7-8-15-16(11-14)25-18(19,20)24-15/h3-8,11H,2,9-10H2,1H3 |
| InChIKey | HEGZYAIRQRYKBW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |