C16H16F2O6 — CID 118545095
ethyl 7-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,4-dioxoheptanoate (PubChem CID 118545095) has the molecular formula C16H16F2O6 and a molecular weight of 342.29 g/mol. Its IUPAC name is ethyl 7-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,4-dioxoheptanoate.
| Compound Name | ethyl 7-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,4-dioxoheptanoate |
|---|---|
| PubChem CID | 118545095 |
| Molecular Formula | C16H16F2O6 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | ethyl 7-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,4-dioxoheptanoate |
| SMILES | CCOC(=O)C(=O)CC(=O)CCCc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C16H16F2O6/c1-2-22-15(21)12(20)9-11(19)5-3-4-10-6-7-13-14(8-10)24-16(17,18)23-13/h6-8H,2-5,9H2,1H3 |
| InChIKey | AEIUVNWNHJBQAR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|