C16H19BrO4 — CID 69113284
ethyl 5-(bromomethyl)spiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-carboxylate (PubChem CID 69113284) has the molecular formula C16H19BrO4 and a molecular weight of 355.23 g/mol. Its IUPAC name is ethyl 5-(bromomethyl)spiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-carboxylate.
| Compound Name | ethyl 5-(bromomethyl)spiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-carboxylate |
|---|---|
| PubChem CID | 69113284 |
| Molecular Formula | C16H19BrO4 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | ethyl 5-(bromomethyl)spiro[1,3-benzodioxole-2,4'-cyclohexane]-1'-carboxylate |
| SMILES | CCOC(=O)C1CCC2(CC1)Oc1ccc(CBr)cc1O2 |
| InChI | InChI=1S/C16H19BrO4/c1-2-19-15(18)12-5-7-16(8-6-12)20-13-4-3-11(10-17)9-14(13)21-16/h3-4,9,12H,2,5-8,10H2,1H3 |
| InChIKey | MCCPKIXDJHPNMJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|