C16H18O5 — CID 117468926
ethyl 2-oxo-2-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylacetate (PubChem CID 117468926) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl 2-oxo-2-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylacetate.
| Compound Name | ethyl 2-oxo-2-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylacetate |
|---|---|
| PubChem CID | 117468926 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | ethyl 2-oxo-2-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylacetate |
| SMILES | CCOC(=O)C(=O)c1ccc2c(c1)OC1(CCCCC1)O2 |
| InChI | InChI=1S/C16H18O5/c1-2-19-15(18)14(17)11-6-7-12-13(10-11)21-16(20-12)8-4-3-5-9-16/h6-7,10H,2-5,8-9H2,1H3 |
| InChIKey | XBBOJHXUXQLNFW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|