C18H20N2O4 — CID 71900689
ethyl 2-cyano-3-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)prop-2-enoate (PubChem CID 71900689) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is ethyl 2-cyano-3-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)prop-2-enoate |
|---|---|
| PubChem CID | 71900689 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | ethyl 2-cyano-3-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=CNc1ccc2c(c1)OC1(CCCCC1)O2 |
| InChI | InChI=1S/C18H20N2O4/c1-2-22-17(21)13(11-19)12-20-14-6-7-15-16(10-14)24-18(23-15)8-4-3-5-9-18/h6-7,10,12,20H,2-5,8-9H2,1H3 |
| InChIKey | SIPOBBZYDSAJNC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|