C10H8Cl2O4 — CID 52911141
ethyl 2,2-dichloro-1,3-benzodioxole-5-carboxylate (PubChem CID 52911141) has the molecular formula C10H8Cl2O4 and a molecular weight of 263.08 g/mol. Its IUPAC name is ethyl 2,2-dichloro-1,3-benzodioxole-5-carboxylate.
| Compound Name | ethyl 2,2-dichloro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 52911141 |
| Molecular Formula | C10H8Cl2O4 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | ethyl 2,2-dichloro-1,3-benzodioxole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)OC(Cl)(Cl)O2 |
| InChI | InChI=1S/C10H8Cl2O4/c1-2-14-9(13)6-3-4-7-8(5-6)16-10(11,12)15-7/h3-5H,2H2,1H3 |
| InChIKey | OLYCPVVGERXCJQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|