C16H19BrO6 — CID 139706166
diethyl 5-[(2S)-2-bromopropyl]-1,3-benzodioxole-2,2-dicarboxylate (PubChem CID 139706166) has the molecular formula C16H19BrO6 and a molecular weight of 387.23 g/mol. Its IUPAC name is diethyl 5-[(2S)-2-bromopropyl]-1,3-benzodioxole-2,2-dicarboxylate.
| Compound Name | diethyl 5-[(2S)-2-bromopropyl]-1,3-benzodioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 139706166 |
| Molecular Formula | C16H19BrO6 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | diethyl 5-[(2S)-2-bromopropyl]-1,3-benzodioxole-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Oc2ccc(C[C@H](C)Br)cc2O1 |
| InChI | InChI=1S/C16H19BrO6/c1-4-20-14(18)16(15(19)21-5-2)22-12-7-6-11(8-10(3)17)9-13(12)23-16/h6-7,9-10H,4-5,8H2,1-3H3/t10-/m0/s1 |
| InChIKey | HEESVGAAVVMLKN-JTQLQIEISA-N |
| XLogP | 2.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|