C15H20N2O6 — CID 163741424
diethyl 5-(2,2-diaminoethyl)-1,3-benzodioxole-2,2-dicarboxylate (PubChem CID 163741424) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is diethyl 5-(2,2-diaminoethyl)-1,3-benzodioxole-2,2-dicarboxylate.
| Compound Name | diethyl 5-(2,2-diaminoethyl)-1,3-benzodioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 163741424 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | diethyl 5-(2,2-diaminoethyl)-1,3-benzodioxole-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Oc2ccc(CC(N)N)cc2O1 |
| InChI | InChI=1S/C15H20N2O6/c1-3-20-13(18)15(14(19)21-4-2)22-10-6-5-9(8-12(16)17)7-11(10)23-15/h5-7,12H,3-4,8,16-17H2,1-2H3 |
| InChIKey | LIBZSAWJIFAXIC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|