C12H12O7 — CID 139706179
5-[(2R)-2-hydroxypropyl]-1,3-benzodioxole-2,2-dicarboxylic acid (PubChem CID 139706179) has the molecular formula C12H12O7 and a molecular weight of 268.22 g/mol. Its IUPAC name is 5-[(2R)-2-hydroxypropyl]-1,3-benzodioxole-2,2-dicarboxylic acid.
| Compound Name | 5-[(2R)-2-hydroxypropyl]-1,3-benzodioxole-2,2-dicarboxylic acid |
|---|---|
| PubChem CID | 139706179 |
| Molecular Formula | C12H12O7 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 5-[(2R)-2-hydroxypropyl]-1,3-benzodioxole-2,2-dicarboxylic acid |
| SMILES | C[C@@H](O)Cc1ccc2c(c1)OC(C(=O)O)(C(=O)O)O2 |
| InChI | InChI=1S/C12H12O7/c1-6(13)4-7-2-3-8-9(5-7)19-12(18-8,10(14)15)11(16)17/h2-3,5-6,13H,4H2,1H3,(H,14,15)(H,16,17)/t6-/m1/s1 |
| InChIKey | CNMIUXBDEFPXIY-ZCFIWIBFSA-N |
| XLogP | 0.25 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|