C21H22ClNO7 — CID 67741515
5-[(3R)-3-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylic acid (PubChem CID 67741515) has the molecular formula C21H22ClNO7 and a molecular weight of 435.86 g/mol. Its IUPAC name is 5-[(3R)-3-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylic acid.
| Compound Name | 5-[(3R)-3-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylic acid |
|---|---|
| PubChem CID | 67741515 |
| Molecular Formula | C21H22ClNO7 |
| Molecular Weight | 435.86 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 5-[(3R)-3-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylic acid |
| SMILES | C[C@H](CCc1ccc2c(c1)OC(C(=O)O)(C(=O)O)O2)NC[C@H](O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H22ClNO7/c1-12(23-11-16(24)14-3-2-4-15(22)10-14)5-6-13-7-8-17-18(9-13)30-21(29-17,19(25)26)20(27)28/h2-4,7-10,12,16,23-24H,5-6,11H2,1H3,(H,25,26)(H,27,28)/t12-,16+/m1/s1 |
| InChIKey | DNBLORBSMVKHDN-WBMJQRKESA-N |
| XLogP | 2.62 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.86 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|