C34H48ClNO9 — CID 100937824
bis(2-pentoxyethyl) 5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate (PubChem CID 100937824) has the molecular formula C34H48ClNO9 and a molecular weight of 650.21 g/mol. Its IUPAC name is bis(2-pentoxyethyl) 5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate.
| Compound Name | bis(2-pentoxyethyl) 5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 100937824 |
| Molecular Formula | C34H48ClNO9 |
| Molecular Weight | 650.21 g/mol |
| Exact Mass | 649.30 |
| IUPAC Name | bis(2-pentoxyethyl) 5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate |
| SMILES | CCCCCOCCOC(=O)C1(C(=O)OCCOCCCCC)Oc2ccc(C[C@@H](C)NC[C@H](O)c3cccc(Cl)c3)cc2O1 |
| InChI | InChI=1S/C34H48ClNO9/c1-4-6-8-15-40-17-19-42-32(38)34(33(39)43-20-18-41-16-9-7-5-2)44-30-14-13-26(22-31(30)45-34)21-25(3)36-24-29(37)27-11-10-12-28(35)23-27/h10-14,22-23,25,29,36-37H,4-9,15-21,24H2,1-3H3/t25-,29+/m1/s1 |
| InChIKey | RVRUZWGSTMEWPL-IRPSRAIASA-N |
| XLogP | 5.56 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.21 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|