C30H40ClNO7S — CID 151741040
dibutyl 5-[2-[[2-(4-chloro-3-methylsulfanylphenyl)-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylate (PubChem CID 151741040) has the molecular formula C30H40ClNO7S and a molecular weight of 594.17 g/mol. Its IUPAC name is dibutyl 5-[2-[[2-(4-chloro-3-methylsulfanylphenyl)-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylate.
| Compound Name | dibutyl 5-[2-[[2-(4-chloro-3-methylsulfanylphenyl)-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 151741040 |
| Molecular Formula | C30H40ClNO7S |
| Molecular Weight | 594.17 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | dibutyl 5-[2-[[2-(4-chloro-3-methylsulfanylphenyl)-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylate |
| SMILES | CCCCOC(=O)C1(C(=O)OCCCC)Oc2ccc(CC(CC)NCC(O)c3ccc(Cl)c(SC)c3)cc2O1 |
| InChI | InChI=1S/C30H40ClNO7S/c1-5-8-14-36-28(34)30(29(35)37-15-9-6-2)38-25-13-10-20(17-26(25)39-30)16-22(7-3)32-19-24(33)21-11-12-23(31)27(18-21)40-4/h10-13,17-18,22,24,32-33H,5-9,14-16,19H2,1-4H3 |
| InChIKey | RMNPLADIWGDMSQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.17 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|