C38H36ClNO7 — CID 67581074
bis(3-phenylprop-2-enyl) 5-[(2R)-2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate (PubChem CID 67581074) has the molecular formula C38H36ClNO7 and a molecular weight of 654.16 g/mol. Its IUPAC name is bis(3-phenylprop-2-enyl) 5-[(2R)-2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate.
| Compound Name | bis(3-phenylprop-2-enyl) 5-[(2R)-2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 67581074 |
| Molecular Formula | C38H36ClNO7 |
| Molecular Weight | 654.16 g/mol |
| Exact Mass | 653.22 |
| IUPAC Name | bis(3-phenylprop-2-enyl) 5-[(2R)-2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate |
| SMILES | C[C@H](Cc1ccc2c(c1)OC(C(=O)OCC=Cc1ccccc1)(C(=O)OCC=Cc1ccccc1)O2)NCC(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C38H36ClNO7/c1-27(40-26-33(41)31-17-8-18-32(39)25-31)23-30-19-20-34-35(24-30)47-38(46-34,36(42)44-21-9-15-28-11-4-2-5-12-28)37(43)45-22-10-16-29-13-6-3-7-14-29/h2-20,24-25,27,33,40-41H,21-23,26H2,1H3/t27-,33?,38?/m1/s1 |
| InChIKey | FLXYKQDHSXRSTQ-CQMZFRMSSA-N |
| XLogP | 6.57 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.16 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|