C21H21F2NO8 — CID 18996363
5-[2-[[2-[3-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylic acid (PubChem CID 18996363) has the molecular formula C21H21F2NO8 and a molecular weight of 453.39 g/mol. Its IUPAC name is 5-[2-[[2-[3-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylic acid.
| Compound Name | 5-[2-[[2-[3-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylic acid |
|---|---|
| PubChem CID | 18996363 |
| Molecular Formula | C21H21F2NO8 |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 5-[2-[[2-[3-(difluoromethoxy)phenyl]-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylic acid |
| SMILES | CC(Cc1ccc2c(c1)OC(C(=O)O)(C(=O)O)O2)NCC(O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C21H21F2NO8/c1-11(24-10-15(25)13-3-2-4-14(9-13)30-20(22)23)7-12-5-6-16-17(8-12)32-21(31-16,18(26)27)19(28)29/h2-6,8-9,11,15,20,24-25H,7,10H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | HWIROSJMNISMHO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|