C27H34ClNO8 — CID 100937825
5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-2-(2-pentoxyethoxycarbonyl)-1,3-benzodioxole-2-carboxylic acid (PubChem CID 100937825) has the molecular formula C27H34ClNO8 and a molecular weight of 536.02 g/mol. Its IUPAC name is 5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-2-(2-pentoxyethoxycarbonyl)-1,3-benzodioxole-2-carboxylic acid.
| Compound Name | 5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-2-(2-pentoxyethoxycarbonyl)-1,3-benzodioxole-2-carboxylic acid |
|---|---|
| PubChem CID | 100937825 |
| Molecular Formula | C27H34ClNO8 |
| Molecular Weight | 536.02 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-2-(2-pentoxyethoxycarbonyl)-1,3-benzodioxole-2-carboxylic acid |
| SMILES | CCCCCOCCOC(=O)C1(C(=O)O)Oc2ccc(C[C@@H](C)NC[C@H](O)c3cccc(Cl)c3)cc2O1 |
| InChI | InChI=1S/C27H34ClNO8/c1-3-4-5-11-34-12-13-35-26(33)27(25(31)32)36-23-10-9-19(15-24(23)37-27)14-18(2)29-17-22(30)20-7-6-8-21(28)16-20/h6-10,15-16,18,22,29-30H,3-5,11-14,17H2,1-2H3,(H,31,32)/t18-,22+,27?/m1/s1 |
| InChIKey | SZLVMQIRDQRKPI-MUPKGOSDSA-N |
| XLogP | 3.90 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.02 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|