C34H32ClNO7 — CID 54439365
dibenzyl 5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate (PubChem CID 54439365) has the molecular formula C34H32ClNO7 and a molecular weight of 602.08 g/mol. Its IUPAC name is dibenzyl 5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate.
| Compound Name | dibenzyl 5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 54439365 |
| Molecular Formula | C34H32ClNO7 |
| Molecular Weight | 602.08 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | dibenzyl 5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate |
| SMILES | CC(Cc1ccc2c(c1)OC(C(=O)OCc1ccccc1)(C(=O)OCc1ccccc1)O2)NCC(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C34H32ClNO7/c1-23(36-20-29(37)27-13-8-14-28(35)19-27)17-26-15-16-30-31(18-26)43-34(42-30,32(38)40-21-24-9-4-2-5-10-24)33(39)41-22-25-11-6-3-7-12-25/h2-16,18-19,23,29,36-37H,17,20-22H2,1H3 |
| InChIKey | WMZLOAORDSQZFM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.08 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|