C20H18ClNO7-2 — CID 4281354
5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate (PubChem CID 4281354) has the molecular formula C20H18ClNO7-2 and a molecular weight of 419.82 g/mol. Its IUPAC name is 5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate.
| Compound Name | 5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 4281354 |
| Molecular Formula | C20H18ClNO7-2 |
| Molecular Weight | 419.82 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate |
| SMILES | CC(Cc1ccc2c(c1)OC(C(=O)[O-])(C(=O)[O-])O2)NCC(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H20ClNO7/c1-11(22-10-15(23)13-3-2-4-14(21)9-13)7-12-5-6-16-17(8-12)29-20(28-16,18(24)25)19(26)27/h2-6,8-9,11,15,22-23H,7,10H2,1H3,(H,24,25)(H,26,27)/p-2 |
| InChIKey | JEDJMKTVUPSHFW-UHFFFAOYSA-L |
| XLogP | -0.44 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.82 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|