C21H20ClNNa2O8 — CID 15340705
disodium;5-[(2R)-2-[[(2R)-3-(3-chlorophenoxy)-2-hydroxypropyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate (PubChem CID 15340705) has the molecular formula C21H20ClNNa2O8 and a molecular weight of 495.82 g/mol. Its IUPAC name is disodium;5-[(2R)-2-[[(2R)-3-(3-chlorophenoxy)-2-hydroxypropyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate.
| Compound Name | disodium;5-[(2R)-2-[[(2R)-3-(3-chlorophenoxy)-2-hydroxypropyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 15340705 |
| Molecular Formula | C21H20ClNNa2O8 |
| Molecular Weight | 495.82 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | disodium;5-[(2R)-2-[[(2R)-3-(3-chlorophenoxy)-2-hydroxypropyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate |
| SMILES | C[C@H](Cc1ccc2c(c1)OC(C(=O)[O-])(C(=O)[O-])O2)NC[C@@H](O)COc1cccc(Cl)c1.[Na+].[Na+] |
| InChI | InChI=1S/C21H22ClNO8.2Na/c1-12(23-10-15(24)11-29-16-4-2-3-14(22)9-16)7-13-5-6-17-18(8-13)31-21(30-17,19(25)26)20(27)28;;/h2-6,8-9,12,15,23-24H,7,10-11H2,1H3,(H,25,26)(H,27,28);;/q;2*+1/p-2/t12-,15-;;/m1../s1 |
| InChIKey | VAHSGEFRIAZGDK-DGPOFWGLSA-L |
| XLogP | -6.72 |
| TPSA | 140.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.82 |
| LogP ≤ 5 | -6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|