C12H10O7-2 — CID 21192325
5-(2-hydroxypropyl)-1,3-benzodioxole-2,2-dicarboxylate (PubChem CID 21192325) has the molecular formula C12H10O7-2 and a molecular weight of 266.20 g/mol. Its IUPAC name is 5-(2-hydroxypropyl)-1,3-benzodioxole-2,2-dicarboxylate.
| Compound Name | 5-(2-hydroxypropyl)-1,3-benzodioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 21192325 |
| Molecular Formula | C12H10O7-2 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 5-(2-hydroxypropyl)-1,3-benzodioxole-2,2-dicarboxylate |
| SMILES | CC(O)Cc1ccc2c(c1)OC(C(=O)[O-])(C(=O)[O-])O2 |
| InChI | InChI=1S/C12H12O7/c1-6(13)4-7-2-3-8-9(5-7)19-12(18-8,10(14)15)11(16)17/h2-3,5-6,13H,4H2,1H3,(H,14,15)(H,16,17)/p-2 |
| InChIKey | CNMIUXBDEFPXIY-UHFFFAOYSA-L |
| XLogP | -2.42 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|