C14H15BrO6 — CID 70233030
dimethyl 5-[(2S)-2-bromopropyl]-1,3-benzodioxole-2,2-dicarboxylate (PubChem CID 70233030) has the molecular formula C14H15BrO6 and a molecular weight of 359.17 g/mol. Its IUPAC name is dimethyl 5-[(2S)-2-bromopropyl]-1,3-benzodioxole-2,2-dicarboxylate.
| Compound Name | dimethyl 5-[(2S)-2-bromopropyl]-1,3-benzodioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 70233030 |
| Molecular Formula | C14H15BrO6 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | dimethyl 5-[(2S)-2-bromopropyl]-1,3-benzodioxole-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Oc2ccc(C[C@H](C)Br)cc2O1 |
| InChI | InChI=1S/C14H15BrO6/c1-8(15)6-9-4-5-10-11(7-9)21-14(20-10,12(16)18-2)13(17)19-3/h4-5,7-8H,6H2,1-3H3/t8-/m0/s1 |
| InChIKey | ZBLACCLGOUEOBE-QMMMGPOBSA-N |
| XLogP | 1.83 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|