C25H32N2O7 — CID 150728490
dimethyl 5-[2-[[2-[4-(dimethylamino)phenyl]-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylate (PubChem CID 150728490) has the molecular formula C25H32N2O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is dimethyl 5-[2-[[2-[4-(dimethylamino)phenyl]-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylate.
| Compound Name | dimethyl 5-[2-[[2-[4-(dimethylamino)phenyl]-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 150728490 |
| Molecular Formula | C25H32N2O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | dimethyl 5-[2-[[2-[4-(dimethylamino)phenyl]-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylate |
| SMILES | CCC(Cc1ccc2c(c1)OC(C(=O)OC)(C(=O)OC)O2)NCC(O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C25H32N2O7/c1-6-18(26-15-20(28)17-8-10-19(11-9-17)27(2)3)13-16-7-12-21-22(14-16)34-25(33-21,23(29)31-4)24(30)32-5/h7-12,14,18,20,26,28H,6,13,15H2,1-5H3 |
| InChIKey | JRIKPYUNZFYAFV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|