C31H44N2O7 — CID 151449941
dibutyl 5-[2-[[2-[3-(dimethylamino)phenyl]-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylate (PubChem CID 151449941) has the molecular formula C31H44N2O7 and a molecular weight of 556.70 g/mol. Its IUPAC name is dibutyl 5-[2-[[2-[3-(dimethylamino)phenyl]-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylate.
| Compound Name | dibutyl 5-[2-[[2-[3-(dimethylamino)phenyl]-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 151449941 |
| Molecular Formula | C31H44N2O7 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | dibutyl 5-[2-[[2-[3-(dimethylamino)phenyl]-2-hydroxyethyl]amino]butyl]-1,3-benzodioxole-2,2-dicarboxylate |
| SMILES | CCCCOC(=O)C1(C(=O)OCCCC)Oc2ccc(CC(CC)NCC(O)c3cccc(N(C)C)c3)cc2O1 |
| InChI | InChI=1S/C31H44N2O7/c1-6-9-16-37-29(35)31(30(36)38-17-10-7-2)39-27-15-14-22(19-28(27)40-31)18-24(8-3)32-21-26(34)23-12-11-13-25(20-23)33(4)5/h11-15,19-20,24,26,32,34H,6-10,16-18,21H2,1-5H3 |
| InChIKey | PGHBCEYMAPTLDO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|