C36H52ClNO7 — CID 139836519
dioctyl 4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate (PubChem CID 139836519) has the molecular formula C36H52ClNO7 and a molecular weight of 646.27 g/mol. Its IUPAC name is dioctyl 4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate.
| Compound Name | dioctyl 4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 139836519 |
| Molecular Formula | C36H52ClNO7 |
| Molecular Weight | 646.27 g/mol |
| Exact Mass | 645.34 |
| IUPAC Name | dioctyl 4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)C1(C(=O)OCCCCCCCC)Oc2cccc(CC(C)NCC(O)c3cccc(Cl)c3)c2O1 |
| InChI | InChI=1S/C36H52ClNO7/c1-4-6-8-10-12-14-22-42-34(40)36(35(41)43-23-15-13-11-9-7-5-2)44-32-21-17-19-29(33(32)45-36)24-27(3)38-26-31(39)28-18-16-20-30(37)25-28/h16-21,25,27,31,38-39H,4-15,22-24,26H2,1-3H3 |
| InChIKey | BMTCHUYQYXBPHX-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.27 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|