C20H20ClNO7 — CID 23434356
4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylic acid (PubChem CID 23434356) has the molecular formula C20H20ClNO7 and a molecular weight of 421.83 g/mol. Its IUPAC name is 4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylic acid.
| Compound Name | 4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylic acid |
|---|---|
| PubChem CID | 23434356 |
| Molecular Formula | C20H20ClNO7 |
| Molecular Weight | 421.83 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylic acid |
| SMILES | CC(Cc1cccc2c1OC(C(=O)O)(C(=O)O)O2)NCC(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H20ClNO7/c1-11(22-10-15(23)12-4-2-6-14(21)9-12)8-13-5-3-7-16-17(13)29-20(28-16,18(24)25)19(26)27/h2-7,9,11,15,22-23H,8,10H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | VIRGTUMSCADPJK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.83 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|