C22H26Cl3NO5 — CID 67741616
5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-dihydroindene-2,2-dicarboxylic acid;dihydrochloride (PubChem CID 67741616) has the molecular formula C22H26Cl3NO5 and a molecular weight of 490.81 g/mol. Its IUPAC name is 5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-dihydroindene-2,2-dicarboxylic acid;dihydrochloride.
| Compound Name | 5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-dihydroindene-2,2-dicarboxylic acid;dihydrochloride |
|---|---|
| PubChem CID | 67741616 |
| Molecular Formula | C22H26Cl3NO5 |
| Molecular Weight | 490.81 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-dihydroindene-2,2-dicarboxylic acid;dihydrochloride |
| SMILES | C[C@H](Cc1ccc2c(c1)CC(C(=O)O)(C(=O)O)C2)NC[C@H](O)c1cccc(Cl)c1.Cl.Cl |
| InChI | InChI=1S/C22H24ClNO5.2ClH/c1-13(24-12-19(25)15-3-2-4-18(23)9-15)7-14-5-6-16-10-22(20(26)27,21(28)29)11-17(16)8-14;;/h2-6,8-9,13,19,24-25H,7,10-12H2,1H3,(H,26,27)(H,28,29);2*1H/t13-,19+;;/m1../s1 |
| InChIKey | MMFHTTXDLJKDGG-KUSVNOJNSA-N |
| XLogP | 3.69 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.81 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|