C21H23ClN2O3 — CID 19079658
5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1-methylindole-2-carboxylic acid (PubChem CID 19079658) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is 5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1-methylindole-2-carboxylic acid.
| Compound Name | 5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1-methylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 19079658 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1-methylindole-2-carboxylic acid |
| SMILES | CC(Cc1ccc2c(c1)cc(C(=O)O)n2C)NCC(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H23ClN2O3/c1-13(23-12-20(25)15-4-3-5-17(22)10-15)8-14-6-7-18-16(9-14)11-19(21(26)27)24(18)2/h3-7,9-11,13,20,23,25H,8,12H2,1-2H3,(H,26,27) |
| InChIKey | RUWSMHJNLRUPME-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |