C24H25Cl2NO — CID 14368686
1-(3-chlorophenyl)-2-[1-[4-[(4-chlorophenyl)methyl]phenyl]propan-2-ylamino]ethanol (PubChem CID 14368686) has the molecular formula C24H25Cl2NO and a molecular weight of 414.38 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[1-[4-[(4-chlorophenyl)methyl]phenyl]propan-2-ylamino]ethanol.
| Compound Name | 1-(3-chlorophenyl)-2-[1-[4-[(4-chlorophenyl)methyl]phenyl]propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 14368686 |
| Molecular Formula | C24H25Cl2NO |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[1-[4-[(4-chlorophenyl)methyl]phenyl]propan-2-ylamino]ethanol |
| SMILES | CC(Cc1ccc(Cc2ccc(Cl)cc2)cc1)NCC(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H25Cl2NO/c1-17(27-16-24(28)21-3-2-4-23(26)15-21)13-18-5-7-19(8-6-18)14-20-9-11-22(25)12-10-20/h2-12,15,17,24,27-28H,13-14,16H2,1H3 |
| InChIKey | AWFMFVZRHSDGNO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |