C27H30ClNO4 — CID 67847911
[2-[[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]methyl]phenyl] ethyl carbonate (PubChem CID 67847911) has the molecular formula C27H30ClNO4 and a molecular weight of 467.99 g/mol. Its IUPAC name is [2-[[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]methyl]phenyl] ethyl carbonate.
| Compound Name | [2-[[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]methyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 67847911 |
| Molecular Formula | C27H30ClNO4 |
| Molecular Weight | 467.99 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | [2-[[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]methyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccccc1Cc1ccc(CC(C)NCC(O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C27H30ClNO4/c1-3-32-27(31)33-26-10-5-4-7-23(26)16-21-13-11-20(12-14-21)15-19(2)29-18-25(30)22-8-6-9-24(28)17-22/h4-14,17,19,25,29-30H,3,15-16,18H2,1-2H3 |
| InChIKey | KXRZVVRDRJWZTD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.99 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|