C26H28ClNO3 — CID 14368687
ethyl 2-[[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]methyl]benzoate (PubChem CID 14368687) has the molecular formula C26H28ClNO3 and a molecular weight of 437.97 g/mol. Its IUPAC name is ethyl 2-[[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]methyl]benzoate.
| Compound Name | ethyl 2-[[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]methyl]benzoate |
|---|---|
| PubChem CID | 14368687 |
| Molecular Formula | C26H28ClNO3 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | ethyl 2-[[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]methyl]benzoate |
| SMILES | CCOC(=O)c1ccccc1Cc1ccc(CCNCC(O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C26H28ClNO3/c1-2-31-26(30)24-9-4-3-6-21(24)16-20-12-10-19(11-13-20)14-15-28-18-25(29)22-7-5-8-23(27)17-22/h3-13,17,25,28-29H,2,14-16,18H2,1H3 |
| InChIKey | VYOZUBWWOQHMJC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|