C27H30ClNO6S — CID 91057604
ethyl 2-[4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-2-methylphenoxy]acetate (PubChem CID 91057604) has the molecular formula C27H30ClNO6S and a molecular weight of 532.06 g/mol. Its IUPAC name is ethyl 2-[4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-2-methylphenoxy]acetate.
| Compound Name | ethyl 2-[4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-2-methylphenoxy]acetate |
|---|---|
| PubChem CID | 91057604 |
| Molecular Formula | C27H30ClNO6S |
| Molecular Weight | 532.06 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | ethyl 2-[4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-2-methylphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(S(=O)(=O)c2ccc(CCNC[C@H](O)c3cccc(Cl)c3)cc2)cc1C |
| InChI | InChI=1S/C27H30ClNO6S/c1-3-34-27(31)18-35-26-12-11-24(15-19(26)2)36(32,33)23-9-7-20(8-10-23)13-14-29-17-25(30)21-5-4-6-22(28)16-21/h4-12,15-16,25,29-30H,3,13-14,17-18H2,1-2H3/t25-/m0/s1 |
| InChIKey | KKSLREZQHGTAQZ-VWLOTQADSA-N |
| XLogP | 4.29 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.06 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|