C26H27Cl2NO6S — CID 91206606
[2-chloro-4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylphenyl] butaneperoxoate (PubChem CID 91206606) has the molecular formula C26H27Cl2NO6S and a molecular weight of 552.48 g/mol. Its IUPAC name is [2-chloro-4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylphenyl] butaneperoxoate.
| Compound Name | [2-chloro-4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylphenyl] butaneperoxoate |
|---|---|
| PubChem CID | 91206606 |
| Molecular Formula | C26H27Cl2NO6S |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | [2-chloro-4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylphenyl] butaneperoxoate |
| SMILES | CCCC(=O)OOc1ccc(S(=O)(=O)c2ccc(CCNC[C@H](O)c3cccc(Cl)c3)cc2)cc1Cl |
| InChI | InChI=1S/C26H27Cl2NO6S/c1-2-4-26(31)35-34-25-12-11-22(16-23(25)28)36(32,33)21-9-7-18(8-10-21)13-14-29-17-24(30)19-5-3-6-20(27)15-19/h3,5-12,15-16,24,29-30H,2,4,13-14,17H2,1H3/t24-/m0/s1 |
| InChIKey | SIXOHZMTJSFQDJ-DEOSSOPVSA-N |
| XLogP | 5.33 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|