C24H25ClN2O6S — CID 11577015
5-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-2-hydroxy-3-methoxybenzamide (PubChem CID 11577015) has the molecular formula C24H25ClN2O6S and a molecular weight of 504.99 g/mol. Its IUPAC name is 5-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-2-hydroxy-3-methoxybenzamide.
| Compound Name | 5-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-2-hydroxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 11577015 |
| Molecular Formula | C24H25ClN2O6S |
| Molecular Weight | 504.99 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 5-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-2-hydroxy-3-methoxybenzamide |
| SMILES | COc1cc(S(=O)(=O)c2ccc(CCNC[C@H](O)c3cccc(Cl)c3)cc2)cc(C(N)=O)c1O |
| InChI | InChI=1S/C24H25ClN2O6S/c1-33-22-13-19(12-20(23(22)29)24(26)30)34(31,32)18-7-5-15(6-8-18)9-10-27-14-21(28)16-3-2-4-17(25)11-16/h2-8,11-13,21,27-29H,9-10,14H2,1H3,(H2,26,30)/t21-/m0/s1 |
| InChIKey | KBEGWBBJCAZIGV-NRFANRHFSA-N |
| XLogP | 2.85 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.99 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|