C27H29ClN2O6S — CID 90802271
ethyl 2-[[3-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylbenzoyl]amino]acetate (PubChem CID 90802271) has the molecular formula C27H29ClN2O6S and a molecular weight of 545.06 g/mol. Its IUPAC name is ethyl 2-[[3-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylbenzoyl]amino]acetate.
| Compound Name | ethyl 2-[[3-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylbenzoyl]amino]acetate |
|---|---|
| PubChem CID | 90802271 |
| Molecular Formula | C27H29ClN2O6S |
| Molecular Weight | 545.06 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | ethyl 2-[[3-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylbenzoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)c1cccc(S(=O)(=O)c2ccc(CCNC[C@H](O)c3cccc(Cl)c3)cc2)c1 |
| InChI | InChI=1S/C27H29ClN2O6S/c1-2-36-26(32)18-30-27(33)21-6-4-8-24(16-21)37(34,35)23-11-9-19(10-12-23)13-14-29-17-25(31)20-5-3-7-22(28)15-20/h3-12,15-16,25,29,31H,2,13-14,17-18H2,1H3,(H,30,33)/t25-/m0/s1 |
| InChIKey | ALRAMFBNTVVSKQ-VWLOTQADSA-N |
| XLogP | 3.33 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.06 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|